C9H10N4O2S2 — CID 113244170
5-nitro-N-(thiolan-3-yl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 113244170) has the molecular formula C9H10N4O2S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-nitro-N-(thiolan-3-yl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-(thiolan-3-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 113244170 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-nitro-N-(thiolan-3-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NC2CCSC2)nc2sccn12 |
| InChI | InChI=1S/C9H10N4O2S2/c14-13(15)8-7(10-6-1-3-16-5-6)11-9-12(8)2-4-17-9/h2,4,6,10H,1,3,5H2 |
| InChIKey | WXXSRONQQZUHOU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|