C9H8N4O4S2 — CID 60678044
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 60678044) has the molecular formula C9H8N4O4S2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 60678044 |
| Molecular Formula | C9H8N4O4S2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NC2C=CS(=O)(=O)C2)nc2sccn12 |
| InChI | InChI=1S/C9H8N4O4S2/c14-13(15)8-7(11-9-12(8)2-3-18-9)10-6-1-4-19(16,17)5-6/h1-4,6,10H,5H2 |
| InChIKey | XIHQUNFZKVEIFT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|