C11H9N5O2S — CID 43471134
4-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)benzene-1,4-diamine (PubChem CID 43471134) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is 4-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43471134 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc3sccn3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9N5O2S/c12-7-1-3-8(4-2-7)13-9-10(16(17)18)15-5-6-19-11(15)14-9/h1-6,13H,12H2 |
| InChIKey | VUYVGWDJYKYFHA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|