C15H15N5O3S — CID 18095042
N-(4-morpholin-4-ylphenyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 18095042) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 18095042 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(N3CCOCC3)cc2)nc2sccn12 |
| InChI | InChI=1S/C15H15N5O3S/c21-20(22)14-13(17-15-19(14)7-10-24-15)16-11-1-3-12(4-2-11)18-5-8-23-9-6-18/h1-4,7,10,16H,5-6,8-9H2 |
| InChIKey | RPFQPYJCTUBTGN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|