C15H14N6O3S — CID 133325017
1-[3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]phenyl]-1,3-diazinan-2-one (PubChem CID 133325017) has the molecular formula C15H14N6O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is 1-[3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 133325017 |
| Molecular Formula | C15H14N6O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1cccc(Nc2nc3sccn3c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N6O3S/c22-14-16-5-2-6-19(14)11-4-1-3-10(9-11)17-12-13(21(23)24)20-7-8-25-15(20)18-12/h1,3-4,7-9,17H,2,5-6H2,(H,16,22) |
| InChIKey | PJOUCUPLRFECDQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|