C17H15F3N4O3 — CID 133325003
1-[3-[2-nitro-4-(trifluoromethyl)anilino]phenyl]-1,3-diazinan-2-one (PubChem CID 133325003) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is 1-[3-[2-nitro-4-(trifluoromethyl)anilino]phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-[2-nitro-4-(trifluoromethyl)anilino]phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 133325003 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[3-[2-nitro-4-(trifluoromethyl)anilino]phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1cccc(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15F3N4O3/c18-17(19,20)11-5-6-14(15(9-11)24(26)27)22-12-3-1-4-13(10-12)23-8-2-7-21-16(23)25/h1,3-6,9-10,22H,2,7-8H2,(H,21,25) |
| InChIKey | AXHNIVUZSUCMBT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|