C16H15N7O2S — CID 133286798
6-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 133286798) has the molecular formula C16H15N7O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 6-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133286798 |
| Molecular Formula | C16H15N7O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 6-[4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(Nc3nc4sccn4c3[N+](=O)[O-])CC2)nc1 |
| InChI | InChI=1S/C16H15N7O2S/c17-9-11-1-2-13(18-10-11)21-5-3-12(4-6-21)19-14-15(23(24)25)22-7-8-26-16(22)20-14/h1-2,7-8,10,12,19H,3-6H2 |
| InChIKey | ZPAHUEWGGLZQKR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|