C16H16FN5O4S2 — CID 55626403
4-fluoro-N-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]benzenesulfonamide (PubChem CID 55626403) has the molecular formula C16H16FN5O4S2 and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-fluoro-N-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55626403 |
| Molecular Formula | C16H16FN5O4S2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-fluoro-N-[1-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1c(N2CCC(NS(=O)(=O)c3ccc(F)cc3)CC2)nc2sccn12 |
| InChI | InChI=1S/C16H16FN5O4S2/c17-11-1-3-13(4-2-11)28(25,26)19-12-5-7-20(8-6-12)14-15(22(23)24)21-9-10-27-16(21)18-14/h1-4,9-10,12,19H,5-8H2 |
| InChIKey | JHEOMUWYQPQVTK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|