C25H22N6 — CID 133286801
6-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 133286801) has the molecular formula C25H22N6 and a molecular weight of 406.49 g/mol. Its IUPAC name is 6-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133286801 |
| Molecular Formula | C25H22N6 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(Nc3nc(-c4ccccc4)c4ccccc4n3)CC2)nc1 |
| InChI | InChI=1S/C25H22N6/c26-16-18-10-11-23(27-17-18)31-14-12-20(13-15-31)28-25-29-22-9-5-4-8-21(22)24(30-25)19-6-2-1-3-7-19/h1-11,17,20H,12-15H2,(H,28,29,30) |
| InChIKey | KHIHHCXTVGSATM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |