C27H26N4O — CID 25071133
2-phenyl-1-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]ethanone (PubChem CID 25071133) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-phenyl-1-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25071133 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-phenyl-1-[4-[(4-phenylquinazolin-2-yl)amino]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCC(Nc2nc(-c3ccccc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H26N4O/c32-25(19-20-9-3-1-4-10-20)31-17-15-22(16-18-31)28-27-29-24-14-8-7-13-23(24)26(30-27)21-11-5-2-6-12-21/h1-14,22H,15-19H2,(H,28,29,30) |
| InChIKey | YIHKSGNMTOHYDK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |