C24H25ClN4O — CID 172590781
1-[4-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one (PubChem CID 172590781) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 172590781 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[4-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(Nc2ncc(Cl)c(-c3cccc(-c4ccccc4)c3)n2)CC1 |
| InChI | InChI=1S/C24H25ClN4O/c1-2-22(30)29-13-11-20(12-14-29)27-24-26-16-21(25)23(28-24)19-10-6-9-18(15-19)17-7-4-3-5-8-17/h3-10,15-16,20H,2,11-14H2,1H3,(H,26,27,28) |
| InChIKey | HVNISVSEARNCOE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |