C22H23ClN4 — CID 172591042
5-chloro-N-(1-methylpiperidin-4-yl)-4-(3-phenylphenyl)pyrimidin-2-amine (PubChem CID 172591042) has the molecular formula C22H23ClN4 and a molecular weight of 378.91 g/mol. Its IUPAC name is 5-chloro-N-(1-methylpiperidin-4-yl)-4-(3-phenylphenyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(1-methylpiperidin-4-yl)-4-(3-phenylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172591042 |
| Molecular Formula | C22H23ClN4 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-chloro-N-(1-methylpiperidin-4-yl)-4-(3-phenylphenyl)pyrimidin-2-amine |
| SMILES | CN1CCC(Nc2ncc(Cl)c(-c3cccc(-c4ccccc4)c3)n2)CC1 |
| InChI | InChI=1S/C22H23ClN4/c1-27-12-10-19(11-13-27)25-22-24-15-20(23)21(26-22)18-9-5-8-17(14-18)16-6-3-2-4-7-16/h2-9,14-15,19H,10-13H2,1H3,(H,24,25,26) |
| InChIKey | ZLSYEHKLUYKLHO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |