C22H23FN4 — CID 172590735
4-N-[5-fluoro-4-(3-phenylphenyl)pyrimidin-2-yl]cyclohexane-1,4-diamine (PubChem CID 172590735) has the molecular formula C22H23FN4 and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-N-[5-fluoro-4-(3-phenylphenyl)pyrimidin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-fluoro-4-(3-phenylphenyl)pyrimidin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 172590735 |
| Molecular Formula | C22H23FN4 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-N-[5-fluoro-4-(3-phenylphenyl)pyrimidin-2-yl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2ncc(F)c(-c3cccc(-c4ccccc4)c3)n2)CC1 |
| InChI | InChI=1S/C22H23FN4/c23-20-14-25-22(26-19-11-9-18(24)10-12-19)27-21(20)17-8-4-7-16(13-17)15-5-2-1-3-6-15/h1-8,13-14,18-19H,9-12,24H2,(H,25,26,27) |
| InChIKey | ZUBCXZGNOJUUJW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |