C22H25FN4O — CID 172591370
N-[(1Z,3E)-4-[3-[2-(cyclohexylamino)-5-fluoropyrimidin-4-yl]phenyl]penta-1,3-dienyl]formamide (PubChem CID 172591370) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(1Z,3E)-4-[3-[2-(cyclohexylamino)-5-fluoropyrimidin-4-yl]phenyl]penta-1,3-dienyl]formamide.
| Compound Name | N-[(1Z,3E)-4-[3-[2-(cyclohexylamino)-5-fluoropyrimidin-4-yl]phenyl]penta-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 172591370 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[(1Z,3E)-4-[3-[2-(cyclohexylamino)-5-fluoropyrimidin-4-yl]phenyl]penta-1,3-dienyl]formamide |
| SMILES | C/C(=C\C=C/NC=O)c1cccc(-c2nc(NC3CCCCC3)ncc2F)c1 |
| InChI | InChI=1S/C22H25FN4O/c1-16(7-6-12-24-15-28)17-8-5-9-18(13-17)21-20(23)14-25-22(27-21)26-19-10-3-2-4-11-19/h5-9,12-15,19H,2-4,10-11H2,1H3,(H,24,28)(H,25,26,27)/b12-6-,16-7+ |
| InChIKey | KQFJXLPQXAYLES-SZXDNFOTSA-N |
| XLogP | 4.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|