C21H23FN4 — CID 172592365
5-fluoro-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-piperidin-4-ylpyrimidin-2-amine (PubChem CID 172592365) has the molecular formula C21H23FN4 and a molecular weight of 350.44 g/mol. Its IUPAC name is 5-fluoro-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-piperidin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-piperidin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 172592365 |
| Molecular Formula | C21H23FN4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-fluoro-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-piperidin-4-ylpyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C)c1cccc(-c2nc(NC3CCNCC3)ncc2F)c1 |
| InChI | InChI=1S/C21H23FN4/c1-3-6-15(4-2)16-7-5-8-17(13-16)20-19(22)14-24-21(26-20)25-18-9-11-23-12-10-18/h3-8,13-14,18,23H,1-2,9-12H2,(H,24,25,26)/b15-6+ |
| InChIKey | PQVMISDHNZCSFV-GIDUJCDVSA-N |
| XLogP | 4.20 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|