C19H18F2N6O — CID 164570334
5-fluoro-4-[8-fluoro-4-(nitrosomethyl)quinolin-6-yl]-N-piperidin-4-ylpyrimidin-2-amine (PubChem CID 164570334) has the molecular formula C19H18F2N6O and a molecular weight of 384.39 g/mol. Its IUPAC name is 5-fluoro-4-[8-fluoro-4-(nitrosomethyl)quinolin-6-yl]-N-piperidin-4-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-4-[8-fluoro-4-(nitrosomethyl)quinolin-6-yl]-N-piperidin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 164570334 |
| Molecular Formula | C19H18F2N6O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-fluoro-4-[8-fluoro-4-(nitrosomethyl)quinolin-6-yl]-N-piperidin-4-ylpyrimidin-2-amine |
| SMILES | O=NCc1ccnc2c(F)cc(-c3nc(NC4CCNCC4)ncc3F)cc12 |
| InChI | InChI=1S/C19H18F2N6O/c20-15-8-12(7-14-11(9-25-28)1-6-23-18(14)15)17-16(21)10-24-19(27-17)26-13-2-4-22-5-3-13/h1,6-8,10,13,22H,2-5,9H2,(H,24,26,27) |
| InChIKey | ICWJTEGMURDWAA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |