C19H19F2N5S — CID 167163320
5-fluoro-4-(8-fluoroquinolin-6-yl)-N-(1-methylsulfanylpiperidin-3-yl)pyrimidin-2-amine (PubChem CID 167163320) has the molecular formula C19H19F2N5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-fluoro-4-(8-fluoroquinolin-6-yl)-N-(1-methylsulfanylpiperidin-3-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(8-fluoroquinolin-6-yl)-N-(1-methylsulfanylpiperidin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 167163320 |
| Molecular Formula | C19H19F2N5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-fluoro-4-(8-fluoroquinolin-6-yl)-N-(1-methylsulfanylpiperidin-3-yl)pyrimidin-2-amine |
| SMILES | CSN1CCCC(Nc2ncc(F)c(-c3cc(F)c4ncccc4c3)n2)C1 |
| InChI | InChI=1S/C19H19F2N5S/c1-27-26-7-3-5-14(11-26)24-19-23-10-16(21)18(25-19)13-8-12-4-2-6-22-17(12)15(20)9-13/h2,4,6,8-10,14H,3,5,7,11H2,1H3,(H,23,24,25) |
| InChIKey | BSXWLRIXDIGQAG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|