C20H22ClN5 — CID 173100889
5-chloro-8-N-(1-methylpiperidin-4-yl)-2-N-phenylquinazoline-2,8-diamine (PubChem CID 173100889) has the molecular formula C20H22ClN5 and a molecular weight of 367.88 g/mol. Its IUPAC name is 5-chloro-8-N-(1-methylpiperidin-4-yl)-2-N-phenylquinazoline-2,8-diamine.
| Compound Name | 5-chloro-8-N-(1-methylpiperidin-4-yl)-2-N-phenylquinazoline-2,8-diamine |
|---|---|
| PubChem CID | 173100889 |
| Molecular Formula | C20H22ClN5 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-chloro-8-N-(1-methylpiperidin-4-yl)-2-N-phenylquinazoline-2,8-diamine |
| SMILES | CN1CCC(Nc2ccc(Cl)c3cnc(Nc4ccccc4)nc23)CC1 |
| InChI | InChI=1S/C20H22ClN5/c1-26-11-9-15(10-12-26)23-18-8-7-17(21)16-13-22-20(25-19(16)18)24-14-5-3-2-4-6-14/h2-8,13,15,23H,9-12H2,1H3,(H,22,24,25) |
| InChIKey | YLSWPYJKSAFGPI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |