C21H21ClN6O — CID 118024502
(4-aminophenyl)-[4-[(5-chloro-4-pyridin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]methanone (PubChem CID 118024502) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is (4-aminophenyl)-[4-[(5-chloro-4-pyridin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-[(5-chloro-4-pyridin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118024502 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (4-aminophenyl)-[4-[(5-chloro-4-pyridin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCC(Nc3ncc(Cl)c(-c4cccnc4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H21ClN6O/c22-18-13-25-21(27-19(18)15-2-1-9-24-12-15)26-17-7-10-28(11-8-17)20(29)14-3-5-16(23)6-4-14/h1-6,9,12-13,17H,7-8,10-11,23H2,(H,25,26,27) |
| InChIKey | YEMKYAYDNNENNW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|