C23H22ClN7O — CID 122542085
(4-aminophenyl)-[4-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone (PubChem CID 122542085) has the molecular formula C23H22ClN7O and a molecular weight of 447.93 g/mol. Its IUPAC name is (4-aminophenyl)-[4-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122542085 |
| Molecular Formula | C23H22ClN7O |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (4-aminophenyl)-[4-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCC(Nc3ncc(Cl)c(-c4c[nH]c5ncccc45)n3)CC2)cc1 |
| InChI | InChI=1S/C23H22ClN7O/c24-19-13-28-23(30-20(19)18-12-27-21-17(18)2-1-9-26-21)29-16-7-10-31(11-8-16)22(32)14-3-5-15(25)6-4-14/h1-6,9,12-13,16H,7-8,10-11,25H2,(H,26,27)(H,28,29,30) |
| InChIKey | UIRXGZAFJYYGPE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|