C24H21ClN6O3 — CID 139379861
[(3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 139379861) has the molecular formula C24H21ClN6O3 and a molecular weight of 476.92 g/mol. Its IUPAC name is [(3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 139379861 |
| Molecular Formula | C24H21ClN6O3 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [(3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCC[C@@H](Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C24H21ClN6O3/c25-20-13-27-24(29-22(20)19-12-26-21-6-2-1-5-18(19)21)28-16-4-3-11-30(14-16)23(32)15-7-9-17(10-8-15)31(33)34/h1-2,5-10,12-13,16,26H,3-4,11,14H2,(H,27,28,29)/t16-/m1/s1 |
| InChIKey | IMWUKQJMJMFYDJ-MRXNPFEDSA-N |
| XLogP | 4.90 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|