C19H20ClN5O2 — CID 118417945
[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamic acid (PubChem CID 118417945) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is [(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamic acid.
| Compound Name | [(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 118417945 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCC[C@@H](Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C19H20ClN5O2/c20-15-10-22-18(23-11-4-3-5-12(8-11)24-19(26)27)25-17(15)14-9-21-16-7-2-1-6-13(14)16/h1-2,6-7,9-12,21,24H,3-5,8H2,(H,26,27)(H,22,23,25)/t11-,12+/m1/s1 |
| InChIKey | IKQXEDPYPGSKST-NEPJUHHUSA-N |
| XLogP | 4.27 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |