C18H19Cl2N5 — CID 118426018
cis-(1S,3R)-1-N-chloro-3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine (PubChem CID 118426018) has the molecular formula C18H19Cl2N5 and a molecular weight of 376.29 g/mol. Its IUPAC name is cis-(1S,3R)-1-N-chloro-3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine.
| Compound Name | cis-(1S,3R)-1-N-chloro-3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118426018 |
| Molecular Formula | C18H19Cl2N5 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | cis-(1S,3R)-1-N-chloro-3-N-[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine |
| SMILES | ClN[C@H]1CCC[C@@H](Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C18H19Cl2N5/c19-15-10-22-18(23-11-4-3-5-12(8-11)25-20)24-17(15)14-9-21-16-7-2-1-6-13(14)16/h1-2,6-7,9-12,21,25H,3-5,8H2,(H,22,23,24)/t11-,12+/m1/s1 |
| InChIKey | QBEULFWMKNNKHR-NEPJUHHUSA-N |
| XLogP | 4.74 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|