C26H31ClN6O — CID 129306581
1-[3-[[[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 129306581) has the molecular formula C26H31ClN6O and a molecular weight of 479.03 g/mol. Its IUPAC name is 1-[3-[[[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129306581 |
| Molecular Formula | C26H31ClN6O |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 1-[3-[[[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(CN[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)C1 |
| InChI | InChI=1S/C26H31ClN6O/c1-2-24(34)33-11-10-17(16-33)13-28-18-6-5-7-19(12-18)31-26-30-15-22(27)25(32-26)21-14-29-23-9-4-3-8-20(21)23/h2-4,8-9,14-15,17-19,28-29H,1,5-7,10-13,16H2,(H,30,31,32)/t17?,18-,19+/m0/s1 |
| InChIKey | ZXSAIOMALFLYFU-JLMCIHFGSA-N |
| XLogP | 4.63 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|