C28H35ClN6O — CID 135255519
1-[4-[[[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]piperidin-1-yl]but-3-en-1-one (PubChem CID 135255519) has the molecular formula C28H35ClN6O and a molecular weight of 507.08 g/mol. Its IUPAC name is 1-[4-[[[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]piperidin-1-yl]but-3-en-1-one.
| Compound Name | 1-[4-[[[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]piperidin-1-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 135255519 |
| Molecular Formula | C28H35ClN6O |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 1-[4-[[[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]piperidin-1-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)N1CCC(CNC2CCCC(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)CC1 |
| InChI | InChI=1S/C28H35ClN6O/c1-2-6-26(36)35-13-11-19(12-14-35)16-30-20-7-5-8-21(15-20)33-28-32-18-24(29)27(34-28)23-17-31-25-10-4-3-9-22(23)25/h2-4,9-10,17-21,30-31H,1,5-8,11-16H2,(H,32,33,34) |
| InChIKey | ABJUTLDDUJHRNY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|