C28H34ClN5O — CID 158181620
1-[3-[2-[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 158181620) has the molecular formula C28H34ClN5O and a molecular weight of 492.07 g/mol. Its IUPAC name is 1-[3-[2-[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 158181620 |
| Molecular Formula | C28H34ClN5O |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-[3-[2-[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(CCC2CCC(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)CC2)C1 |
| InChI | InChI=1S/C28H34ClN5O/c1-2-26(35)34-15-5-6-20(18-34)10-9-19-11-13-21(14-12-19)32-28-31-17-24(29)27(33-28)23-16-30-25-8-4-3-7-22(23)25/h2-4,7-8,16-17,19-21,30H,1,5-6,9-15,18H2,(H,31,32,33) |
| InChIKey | ULKDSMCRYFSGCM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|