C26H31ClN6O — CID 135255743
N-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]piperidin-3-yl]prop-2-enamide (PubChem CID 135255743) has the molecular formula C26H31ClN6O and a molecular weight of 479.03 g/mol. Its IUPAC name is N-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135255743 |
| Molecular Formula | C26H31ClN6O |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCN([C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)C1 |
| InChI | InChI=1S/C26H31ClN6O/c1-2-24(34)30-18-8-6-12-33(16-18)19-9-5-7-17(13-19)31-26-29-15-22(27)25(32-26)21-14-28-23-11-4-3-10-20(21)23/h2-4,10-11,14-15,17-19,28H,1,5-9,12-13,16H2,(H,30,34)(H,29,31,32)/t17-,18+,19+/m1/s1 |
| InChIKey | BNDCMAZGVVBWKP-QYZOEREBSA-N |
| XLogP | 4.77 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|