C25H29ClN6O — CID 140794504
2-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 140794504) has the molecular formula C25H29ClN6O and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | 2-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 140794504 |
| Molecular Formula | C25H29ClN6O |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[(3S)-1-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)[C@@H]1CCN([C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)C1 |
| InChI | InChI=1S/C25H29ClN6O/c1-15(24(27)33)16-9-10-32(14-16)18-6-4-5-17(11-18)30-25-29-13-21(26)23(31-25)20-12-28-22-8-3-2-7-19(20)22/h2-3,7-8,12-13,16-18,28H,1,4-6,9-11,14H2,(H2,27,33)(H,29,30,31)/t16-,17-,18+/m1/s1 |
| InChIKey | HBHVYERVPTXCOO-KURKYZTESA-N |
| XLogP | 4.36 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|