C32H35ClN6O3 — CID 118425898
tert-butyl N-[[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]methyl]-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]carbamate (PubChem CID 118425898) has the molecular formula C32H35ClN6O3 and a molecular weight of 587.12 g/mol. Its IUPAC name is tert-butyl N-[[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]methyl]-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]methyl]-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118425898 |
| Molecular Formula | C32H35ClN6O3 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | tert-butyl N-[[4-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]phenyl]methyl]-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]carbamate |
| SMILES | C=CC(=O)N1CCC[C@@H](N(Cc2ccc(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)cc2)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C32H35ClN6O3/c1-5-28(40)38-16-8-9-23(20-38)39(31(41)42-32(2,3)4)19-21-12-14-22(15-13-21)36-30-35-18-26(33)29(37-30)25-17-34-27-11-7-6-10-24(25)27/h5-7,10-15,17-18,23,34H,1,8-9,16,19-20H2,2-4H3,(H,35,36,37)/t23-/m1/s1 |
| InChIKey | MJVWIYHANCGTEX-HSZRJFAPSA-N |
| XLogP | 6.94 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|