C24H26Cl2N6 — CID 118025385
N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;hydrochloride (PubChem CID 118025385) has the molecular formula C24H26Cl2N6 and a molecular weight of 469.42 g/mol. Its IUPAC name is N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;hydrochloride.
| Compound Name | N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 118025385 |
| Molecular Formula | C24H26Cl2N6 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ccc(CN2CCC(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)CC2)cc1 |
| InChI | InChI=1S/C24H25ClN6.ClH/c25-21-14-28-24(30-23(21)20-13-27-22-4-2-1-3-19(20)22)29-18-9-11-31(12-10-18)15-16-5-7-17(26)8-6-16;/h1-8,13-14,18,27H,9-12,15,26H2,(H,28,29,30);1H |
| InChIKey | OZMROOQFLCRPAG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|