C13H18N4O3S — CID 115682951
[1-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 115682951) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is [1-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 115682951 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [1-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | O=[N+]([O-])c1c(NCC2(CO)CCCCC2)nc2sccn12 |
| InChI | InChI=1S/C13H18N4O3S/c18-9-13(4-2-1-3-5-13)8-14-10-11(17(19)20)16-6-7-21-12(16)15-10/h6-7,14,18H,1-5,8-9H2 |
| InChIKey | BXLNQSMEABODIN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|