C13H17BrO2S — CID 103847340
3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]-2-methyloxolane (PubChem CID 103847340) has the molecular formula C13H17BrO2S and a molecular weight of 317.25 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]-2-methyloxolane.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]-2-methyloxolane |
|---|---|
| PubChem CID | 103847340 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]-2-methyloxolane |
| SMILES | COc1ccc(Br)cc1CSC1CCOC1C |
| InChI | InChI=1S/C13H17BrO2S/c1-9-13(5-6-16-9)17-8-10-7-11(14)3-4-12(10)15-2/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | CLWQCPLWCKNCJZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |