C14H17ClO3S — CID 107752386
1-(3-chloro-4-methoxyphenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone (PubChem CID 107752386) has the molecular formula C14H17ClO3S and a molecular weight of 300.81 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone |
|---|---|
| PubChem CID | 107752386 |
| Molecular Formula | C14H17ClO3S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone |
| SMILES | COc1ccc(C(=O)CSC2CCOC2C)cc1Cl |
| InChI | InChI=1S/C14H17ClO3S/c1-9-14(5-6-18-9)19-8-12(16)10-3-4-13(17-2)11(15)7-10/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | MSWPSQZOZFVGTA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |