C13H14Cl2O2S — CID 107752435
1-(2,4-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone (PubChem CID 107752435) has the molecular formula C13H14Cl2O2S and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone |
|---|---|
| PubChem CID | 107752435 |
| Molecular Formula | C13H14Cl2O2S |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylethanone |
| SMILES | CC1OCCC1SCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O2S/c1-8-13(4-5-17-8)18-7-12(16)10-3-2-9(14)6-11(10)15/h2-3,6,8,13H,4-5,7H2,1H3 |
| InChIKey | VUMKFYICVIOCTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |