C13H14Cl2O2S — CID 106495124
1-(2,4-dichlorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone (PubChem CID 106495124) has the molecular formula C13H14Cl2O2S and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 106495124 |
| Molecular Formula | C13H14Cl2O2S |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
| SMILES | O=C(CSCC1CCCO1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O2S/c14-9-3-4-11(12(15)6-9)13(16)8-18-7-10-2-1-5-17-10/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | LBRDOESYHLKSLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |