C13H15FO2S — CID 106495104
1-(3-fluorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone (PubChem CID 106495104) has the molecular formula C13H15FO2S and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 106495104 |
| Molecular Formula | C13H15FO2S |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanone |
| SMILES | O=C(CSCC1CCCO1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FO2S/c14-11-4-1-3-10(7-11)13(15)9-17-8-12-5-2-6-16-12/h1,3-4,7,12H,2,5-6,8-9H2 |
| InChIKey | LPBPYQMUGPHZIF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |