C12H13FO3 — CID 2758695
3-(1,3-dioxolan-2-yl)-1-(3-fluorophenyl)propan-1-one (PubChem CID 2758695) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-1-(3-fluorophenyl)propan-1-one.
| Compound Name | 3-(1,3-dioxolan-2-yl)-1-(3-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 2758695 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-1-(3-fluorophenyl)propan-1-one |
| SMILES | O=C(CCC1OCCO1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H13FO3/c13-10-3-1-2-9(8-10)11(14)4-5-12-15-6-7-16-12/h1-3,8,12H,4-7H2 |
| InChIKey | FQKMRPDWGXLDMH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |