C13H15BrO3 — CID 24727811
1-(3-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-one (PubChem CID 24727811) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-one.
| Compound Name | 1-(3-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 24727811 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1-(3-bromophenyl)-3-(1,3-dioxan-2-yl)propan-1-one |
| SMILES | O=C(CCC1OCCCO1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrO3/c14-11-4-1-3-10(9-11)12(15)5-6-13-16-7-2-8-17-13/h1,3-4,9,13H,2,5-8H2 |
| InChIKey | NCLLIUUWESDHTC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |