C12H15BrO4S — CID 66473772
2-[2-(3-bromophenyl)sulfonylethyl]-1,3-dioxane (PubChem CID 66473772) has the molecular formula C12H15BrO4S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)sulfonylethyl]-1,3-dioxane.
| Compound Name | 2-[2-(3-bromophenyl)sulfonylethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66473772 |
| Molecular Formula | C12H15BrO4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-[2-(3-bromophenyl)sulfonylethyl]-1,3-dioxane |
| SMILES | O=S(=O)(CCC1OCCCO1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrO4S/c13-10-3-1-4-11(9-10)18(14,15)8-5-12-16-6-2-7-17-12/h1,3-4,9,12H,2,5-8H2 |
| InChIKey | WOWMBFSATFAWES-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |