C13H18BrNO2S — CID 79581656
2-[2-(3-bromophenyl)sulfonylethyl]cyclopentan-1-amine (PubChem CID 79581656) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)sulfonylethyl]cyclopentan-1-amine.
| Compound Name | 2-[2-(3-bromophenyl)sulfonylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 79581656 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-[2-(3-bromophenyl)sulfonylethyl]cyclopentan-1-amine |
| SMILES | NC1CCCC1CCS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c14-11-4-2-5-12(9-11)18(16,17)8-7-10-3-1-6-13(10)15/h2,4-5,9-10,13H,1,3,6-8,15H2 |
| InChIKey | QILQBPDNPPAYMV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |