C13H17Cl2NO2S — CID 79581118
2-[2-(2,6-dichlorophenyl)sulfonylethyl]cyclopentan-1-amine (PubChem CID 79581118) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)sulfonylethyl]cyclopentan-1-amine.
| Compound Name | 2-[2-(2,6-dichlorophenyl)sulfonylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 79581118 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)sulfonylethyl]cyclopentan-1-amine |
| SMILES | NC1CCCC1CCS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S/c14-10-4-2-5-11(15)13(10)19(17,18)8-7-9-3-1-6-12(9)16/h2,4-5,9,12H,1,3,6-8,16H2 |
| InChIKey | NBOGQGRUPGWMGL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |