C16H20Cl2N2O4S2 — CID 158169655
2-(benzenesulfonyl)ethanamine;2-(2,6-dichlorophenyl)sulfonylethanamine (PubChem CID 158169655) has the molecular formula C16H20Cl2N2O4S2 and a molecular weight of 439.39 g/mol. Its IUPAC name is 2-(benzenesulfonyl)ethanamine;2-(2,6-dichlorophenyl)sulfonylethanamine.
| Compound Name | 2-(benzenesulfonyl)ethanamine;2-(2,6-dichlorophenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 158169655 |
| Molecular Formula | C16H20Cl2N2O4S2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-(benzenesulfonyl)ethanamine;2-(2,6-dichlorophenyl)sulfonylethanamine |
| SMILES | NCCS(=O)(=O)c1c(Cl)cccc1Cl.NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H9Cl2NO2S.C8H11NO2S/c9-6-2-1-3-7(10)8(6)14(12,13)5-4-11;9-6-7-12(10,11)8-4-2-1-3-5-8/h1-3H,4-5,11H2;1-5H,6-7,9H2 |
| InChIKey | FXHFSPIJOZLNCB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |