C12H8Cl2O4S2 — CID 21259718
1-(benzenesulfonylsulfonyl)-2,3-dichlorobenzene (PubChem CID 21259718) has the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 1-(benzenesulfonylsulfonyl)-2,3-dichlorobenzene.
| Compound Name | 1-(benzenesulfonylsulfonyl)-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 21259718 |
| Molecular Formula | C12H8Cl2O4S2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | 1-(benzenesulfonylsulfonyl)-2,3-dichlorobenzene |
| SMILES | O=S(=O)(c1ccccc1)S(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl2O4S2/c13-10-7-4-8-11(12(10)14)20(17,18)19(15,16)9-5-2-1-3-6-9/h1-8H |
| InChIKey | HHGOASGZRJRPBN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|