C18H14O4S2 — CID 19980733
1,2-bis(benzenesulfonyl)benzene (PubChem CID 19980733) has the molecular formula C18H14O4S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1,2-bis(benzenesulfonyl)benzene.
| Compound Name | 1,2-bis(benzenesulfonyl)benzene |
|---|---|
| PubChem CID | 19980733 |
| Molecular Formula | C18H14O4S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 1,2-bis(benzenesulfonyl)benzene |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O4S2/c19-23(20,15-9-3-1-4-10-15)17-13-7-8-14-18(17)24(21,22)16-11-5-2-6-12-16/h1-14H |
| InChIKey | GSMMBRRXAPIYSR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |