C17H13NO4S2 — CID 140663815
2,3-bis(benzenesulfonyl)pyridine (PubChem CID 140663815) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,3-bis(benzenesulfonyl)pyridine.
| Compound Name | 2,3-bis(benzenesulfonyl)pyridine |
|---|---|
| PubChem CID | 140663815 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2,3-bis(benzenesulfonyl)pyridine |
| SMILES | O=S(=O)(c1ccccc1)c1cccnc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13NO4S2/c19-23(20,14-8-3-1-4-9-14)16-12-7-13-18-17(16)24(21,22)15-10-5-2-6-11-15/h1-13H |
| InChIKey | LUEMKTURFOEEJB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |