C29H21NO4S2 — CID 175791079
2-[2,5-bis(benzenesulfonyl)-4-phenylphenyl]pyridine (PubChem CID 175791079) has the molecular formula C29H21NO4S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-[2,5-bis(benzenesulfonyl)-4-phenylphenyl]pyridine.
| Compound Name | 2-[2,5-bis(benzenesulfonyl)-4-phenylphenyl]pyridine |
|---|---|
| PubChem CID | 175791079 |
| Molecular Formula | C29H21NO4S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 2-[2,5-bis(benzenesulfonyl)-4-phenylphenyl]pyridine |
| SMILES | O=S(=O)(c1ccccc1)c1cc(-c2ccccn2)c(S(=O)(=O)c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C29H21NO4S2/c31-35(32,23-14-6-2-7-15-23)28-21-26(27-18-10-11-19-30-27)29(20-25(28)22-12-4-1-5-13-22)36(33,34)24-16-8-3-9-17-24/h1-21H |
| InChIKey | TXOTUQGMHVNHHG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |