About 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene
2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene (PubChem CID 102599502) has the molecular formula C25H20O2S
and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene |
| PubChem CID | 102599502 |
| Molecular Formula | C25H20O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20O2S/c1-19-12-15-23(16-13-19)28(26,27)25-18-22(20-8-4-2-5-9-20)14-17-24(25)21-10-6-3-7-11-21/h2-18H,1H3 |
| InChIKey | YRHQONRLVYPDBP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene?
The IUPAC name of 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene (CID 102599502) is 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene.
What is the SMILES notation for 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene?
The canonical SMILES for 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene is Cc1ccc(S(=O)(=O)c2cc(-c3ccccc3)ccc2-c2ccccc2)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene?
The InChIKey is YRHQONRLVYPDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O2S/c1-19-12-15-23(16-13-19)28(26,27)25-18-22(20-8-4-2-5-9-20)14-17-24(25)21-10-6-3-7-11-21/h2-18H,1H3.
What are the key properties of 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene?
2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene has a molecular weight of 384.50 g/mol, XLogP of 6.16, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene is sourced from PubChem (CID 102599502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).