C25H20O2S — CID 102599502
2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene (PubChem CID 102599502) has the molecular formula C25H20O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene.
| Compound Name | 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene |
|---|---|
| PubChem CID | 102599502 |
| Molecular Formula | C25H20O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1,4-diphenylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20O2S/c1-19-12-15-23(16-13-19)28(26,27)25-18-22(20-8-4-2-5-9-20)14-17-24(25)21-10-6-3-7-11-21/h2-18H,1H3 |
| InChIKey | YRHQONRLVYPDBP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |