About benzenesulfonylbenzene;oxalic acid
benzenesulfonylbenzene;oxalic acid (PubChem CID 67897674) has the molecular formula C14H12O6S
and a molecular weight of 308.31 g/mol. Its IUPAC name is benzenesulfonylbenzene;oxalic acid.
Molecular Properties
| Compound Name | benzenesulfonylbenzene;oxalic acid |
| PubChem CID | 67897674 |
| Molecular Formula | C14H12O6S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | benzenesulfonylbenzene;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S.C2H2O4/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-1(4)2(5)6/h1-10H;(H,3,4)(H,5,6) |
| InChIKey | LRZJMUPGRPIBBS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonylbenzene;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonylbenzene;oxalic acid?
The IUPAC name of benzenesulfonylbenzene;oxalic acid (CID 67897674) is benzenesulfonylbenzene;oxalic acid.
What is the SMILES notation for benzenesulfonylbenzene;oxalic acid?
The canonical SMILES for benzenesulfonylbenzene;oxalic acid is O=C(O)C(=O)O.O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzenesulfonylbenzene;oxalic acid?
The InChIKey is LRZJMUPGRPIBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S.C2H2O4/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-1(4)2(5)6/h1-10H;(H,3,4)(H,5,6).
What are the key properties of benzenesulfonylbenzene;oxalic acid?
benzenesulfonylbenzene;oxalic acid has a molecular weight of 308.31 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonylbenzene;oxalic acid is sourced from PubChem (CID 67897674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).