About aminothiourea;benzenesulfonylbenzene
aminothiourea;benzenesulfonylbenzene (PubChem CID 159260288) has the molecular formula C13H15N3O2S2
and a molecular weight of 309.42 g/mol. Its IUPAC name is aminothiourea;benzenesulfonylbenzene.
Molecular Properties
| Compound Name | aminothiourea;benzenesulfonylbenzene |
| PubChem CID | 159260288 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | aminothiourea;benzenesulfonylbenzene |
| SMILES | NNC(N)=S.O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S.CH5N3S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(5)4-3/h1-10H;3H2,(H3,2,4,5) |
| InChIKey | KWKNHUBPKKOQBR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze aminothiourea;benzenesulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminothiourea;benzenesulfonylbenzene?
The IUPAC name of aminothiourea;benzenesulfonylbenzene (CID 159260288) is aminothiourea;benzenesulfonylbenzene.
What is the SMILES notation for aminothiourea;benzenesulfonylbenzene?
The canonical SMILES for aminothiourea;benzenesulfonylbenzene is NNC(N)=S.O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of aminothiourea;benzenesulfonylbenzene?
The InChIKey is KWKNHUBPKKOQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S.CH5N3S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(5)4-3/h1-10H;3H2,(H3,2,4,5).
What are the key properties of aminothiourea;benzenesulfonylbenzene?
aminothiourea;benzenesulfonylbenzene has a molecular weight of 309.42 g/mol, XLogP of 1.21, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminothiourea;benzenesulfonylbenzene is sourced from PubChem (CID 159260288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).