About benzenesulfonylbenzene;formonitrile
benzenesulfonylbenzene;formonitrile (PubChem CID 174749173) has the molecular formula C13H11NO2S
and a molecular weight of 245.30 g/mol. Its IUPAC name is benzenesulfonylbenzene;formonitrile.
Molecular Properties
| Compound Name | benzenesulfonylbenzene;formonitrile |
| PubChem CID | 174749173 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | benzenesulfonylbenzene;formonitrile |
| SMILES | C#N.O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S.CHN/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10H;1H |
| InChIKey | NCLQGTCHDNTQIP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzenesulfonylbenzene;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonylbenzene;formonitrile?
The IUPAC name of benzenesulfonylbenzene;formonitrile (CID 174749173) is benzenesulfonylbenzene;formonitrile.
What is the SMILES notation for benzenesulfonylbenzene;formonitrile?
The canonical SMILES for benzenesulfonylbenzene;formonitrile is C#N.O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzenesulfonylbenzene;formonitrile?
The InChIKey is NCLQGTCHDNTQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S.CHN/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10H;1H.
What are the key properties of benzenesulfonylbenzene;formonitrile?
benzenesulfonylbenzene;formonitrile has a molecular weight of 245.30 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonylbenzene;formonitrile is sourced from PubChem (CID 174749173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).